Dimethyl benzofuran-2,3-dicarboxylate
Modify Date: 2026-09-14 17:56:04
Dimethyl benzofuran-2,3-dicarboxylate structure
|
Common Name | Dimethyl benzofuran-2,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 28241-92-1 | Molecular Weight | 234.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dimethyl benzofuran-2,3-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10O5 |
|---|---|
| Molecular Weight | 234.20 |
| InChIKey | QBQRNSGPMRMGLO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1oc2ccccc2c1C(=O)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Dimethyl benzofuran-2,3-dicarboxylate? |
| A: InChIKey of Dimethyl benzofuran-2,3-dicarboxylate is QBQRNSGPMRMGLO-UHFFFAOYSA-N. |
| Q: What is the English name of Dimethyl benzofuran-2,3-dicarboxylate? |
| A: The English name of Dimethyl benzofuran-2,3-dicarboxylate is Dimethyl benzofuran-2,3-dicarboxylate. |
| Q: What is the SMILES notation of Dimethyl benzofuran-2,3-dicarboxylate? |
| A: SMILES notation of Dimethyl benzofuran-2,3-dicarboxylate is COC(=O)c1oc2ccccc2c1C(=O)OC. |
| Q: What is the CAS number of Dimethyl benzofuran-2,3-dicarboxylate? |
| A: CAS number of Dimethyl benzofuran-2,3-dicarboxylate is 28241-92-1. |
| Q: What is the molecular weight of Dimethyl benzofuran-2,3-dicarboxylate? |
| A: Molecular weight of Dimethyl benzofuran-2,3-dicarboxylate is 234.20. |
| Q: What is the molecular formula of Dimethyl benzofuran-2,3-dicarboxylate? |
| A: Molecular formula of Dimethyl benzofuran-2,3-dicarboxylate is C12H10O5. |
| Q: What is the Chinese name of 28241-92-1? |
| A: Chinese name of 28241-92-1 is 28241-92-1. |