2,3,4,6-Tetra-O-Acetylhexopyranosyl Fluoride structure
|
Common Name | 2,3,4,6-Tetra-O-Acetylhexopyranosyl Fluoride | ||
|---|---|---|---|---|
| CAS Number | 2823-44-1 | Molecular Weight | 350.29400 | |
| Density | 1.3g/cm3 | Boiling Point | 374.8ºC at 760 mmHg | |
| Molecular Formula | C14H19FO9 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 174.3ºC | |
| Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-fluorooxan-2-yl]methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 374.8ºC at 760 mmHg |
| Molecular Formula | C14H19FO9 |
| Molecular Weight | 350.29400 |
| Flash Point | 174.3ºC |
| Exact Mass | 350.10100 |
| PSA | 114.43000 |
| LogP | 0.03900 |
| Vapour Pressure | 8.11E-06mmHg at 25°C |
| Index of Refraction | 1.464 |
| InChIKey | JJXATNWYELAACC-DGTMBMJNSA-N |
| SMILES | CC(=O)OCC1OC(F)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 2,3,4,6-Tetra-O-acetyl-|A-D-mannopyranosyl fluoride |
| 2,3,3',5,5'-PENTACB |
| Acetofluoro-|A-D-mannose |
| 2,3,4,6-Tetra-O-Acetylhexopyranosyl Fluoride |