TNG-0746132
Modify Date: 2025-08-28 21:14:14
TNG-0746132 structure
|
Common Name | TNG-0746132 | ||
|---|---|---|---|---|
| CAS Number | 2821749-57-7 | Molecular Weight | 505.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H22F3N7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TNG-0746132TNG-0746132 can be used for synthesis of the compound with anticancer activity[1]. |
| Name | TNG-0746132 |
|---|
| Description | TNG-0746132 can be used for synthesis of the compound with anticancer activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H22F3N7O |
|---|---|
| Molecular Weight | 505.49 |
| InChIKey | ONJHDRGRJAZAHT-UHFFFAOYSA-N |
| SMILES | COc1ncnc(C2CC2)c1-c1ncc2[nH]cc(Cc3ccc(-c4nc(C(F)(F)F)cn4C)cc3)c2n1 |