1H-Pyrazole-4-carboxamide,5-amino-1-b-D-ribofuranosyl- structure
|
Common Name | 1H-Pyrazole-4-carboxamide,5-amino-1-b-D-ribofuranosyl- | ||
|---|---|---|---|---|
| CAS Number | 28217-57-4 | Molecular Weight | 258.23100 | |
| Density | 2.06g/cm3 | Boiling Point | 650.8ºC at 760 mmHg | |
| Molecular Formula | C9H14N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.4ºC | |
| Name | 5-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrazole-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.06g/cm3 |
|---|---|
| Boiling Point | 650.8ºC at 760 mmHg |
| Molecular Formula | C9H14N4O5 |
| Molecular Weight | 258.23100 |
| Flash Point | 347.4ºC |
| Exact Mass | 258.09600 |
| PSA | 156.85000 |
| Vapour Pressure | 8.02E-18mmHg at 25°C |
| Index of Refraction | 1.821 |
| InChIKey | ISEWZMIZSXBSTC-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cnn(C2OC(CO)C(O)C2O)c1N |
|
~79%
1H-Pyrazole-4-c... CAS#:28217-57-4 |
| Literature: Bhattacharya; Robins; Revankar Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 3 p. 795 - 801 |
|
~%
1H-Pyrazole-4-c... CAS#:28217-57-4 |
| Literature: Byk Gulden Lomberg Chemische Fabrik GmbH Patent: US4021542 A1, 1977 ; |
|
~%
1H-Pyrazole-4-c... CAS#:28217-57-4 |
| Literature: Bhattacharya; Robins; Revankar Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 3 p. 795 - 801 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-amino-1-pentofuranosyl-1h-pyrazole-4-carboxamide |