1-butan-2-yl-2-(1,1,2,2-tetrafluoroethoxy)benzene
Modify Date: 2024-02-01 16:22:29
1-butan-2-yl-2-(1,1,2,2-tetrafluoroethoxy)benzene structure
|
Common Name | 1-butan-2-yl-2-(1,1,2,2-tetrafluoroethoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 28202-34-8 | Molecular Weight | 250.23300 | |
| Density | 1.143g/cm3 | Boiling Point | 240.1ºC at 760mmHg | |
| Molecular Formula | C12H14F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.9ºC | |
| Name | 1-butan-2-yl-2-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 240.1ºC at 760mmHg |
| Molecular Formula | C12H14F4O |
| Molecular Weight | 250.23300 |
| Flash Point | 96.9ºC |
| Exact Mass | 250.09800 |
| PSA | 9.23000 |
| LogP | 4.43680 |
| Vapour Pressure | 0.0597mmHg at 25°C |
| Index of Refraction | 1.433 |
| InChIKey | SMCZQFGFHZYFQG-UHFFFAOYSA-N |
| SMILES | CCC(C)c1ccccc1OC(F)(F)C(F)F |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(butan-2-yl)-2-(1,1,2,2-tetrafluoroethoxy)benzene |