3-Chloro-N-(4-chlorophenyl)-4-pyridinecarboxamide structure
|
Common Name | 3-Chloro-N-(4-chlorophenyl)-4-pyridinecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 280556-78-7 | Molecular Weight | 267.11100 | |
| Density | 1.44g/cm3 | Boiling Point | 325.941ºC at 760 mmHg | |
| Molecular Formula | C12H8Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.924ºC | |
| Name | 3-chloro-N-(4-chlorophenyl)pyridine-4-carboxamide |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 325.941ºC at 760 mmHg |
| Molecular Formula | C12H8Cl2N2O |
| Molecular Weight | 267.11100 |
| Flash Point | 150.924ºC |
| Exact Mass | 266.00100 |
| PSA | 45.48000 |
| LogP | 4.02470 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | IVGHKDVZQUTNRZ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccncc1Cl |
|
~38%
Detail
|
| Literature: Eli Lilly and Company Patent: US6610704 B1, 2003 ; US 6610704 B1 |