2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide
Modify Date: 2026-07-08 19:02:46
![2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide Structure](https://www.chemsrc.com/extcaspic/041/2805078-16-2.png)
2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide structure
|
Common Name | 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 2805078-16-2 | Molecular Weight | 281.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H10F3NO2 |
|---|---|
| Molecular Weight | 281.23 |
| InChIKey | XJFTUZPLAJYTOE-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(-c2ccc(C(F)(F)F)cc2)c(O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide? |
| A: Molecular formula of 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide is C14H10F3NO2. |
| Q: What is the molecular weight of 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide? |
| A: Molecular weight of 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide is 281.23. |
| Q: What is the CAS number of 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide? |
| A: CAS number of 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide is 2805078-16-2. |
| Q: What is the InChIKey of 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide? |
| A: InChIKey of 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide is XJFTUZPLAJYTOE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2805078-16-2? |
| A: Chinese name of 2805078-16-2 is 2805078-16-2. |
| Q: What is the English name of 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide? |
| A: The English name of 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide is 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide. |
| Q: What is the SMILES notation of 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide? |
| A: SMILES notation of 2-Hydroxy-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxamide is NC(=O)c1ccc(-c2ccc(C(F)(F)F)cc2)c(O)c1. |