8-Nitro-2,4-dimethylquinoline structure
|
Common Name | 8-Nitro-2,4-dimethylquinoline | ||
|---|---|---|---|---|
| CAS Number | 2801-28-7 | Molecular Weight | 202.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dimethyl-8-nitro-quinoline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10N2O2 |
|---|---|
| Molecular Weight | 202.20900 |
| Exact Mass | 202.07400 |
| PSA | 58.71000 |
| LogP | 3.28300 |
| InChIKey | ACDJJRZSUBAOSM-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2cccc([N+](=O)[O-])c2n1 |
| HS Code | 2933499090 |
|---|
|
~%
8-Nitro-2,4-dim... CAS#:2801-28-7 |
| Literature: Roberts; Turner Journal of the Chemical Society, 1927 , p. 1842 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Nitro-2,4-dimethyl-chinolin |
| 2,4-Dimethyl-8-nitro-chinolin |