L-lysine mono(1,2,3,6-tetrahydro-2,6-dioxopyrimidine-4-carboxylate)
Modify Date: 2025-09-21 10:39:50
L-lysine mono(1,2,3,6-tetrahydro-2,6-dioxopyrimidine-4-carboxylate) structure
|
Common Name | L-lysine mono(1,2,3,6-tetrahydro-2,6-dioxopyrimidine-4-carboxylate) | ||
|---|---|---|---|---|
| CAS Number | 28003-86-3 | Molecular Weight | 302.284 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-lysine mono(1,2,3,6-tetrahydro-2,6-dioxopyrimidine-4-carboxylate)L-Lysine orotate is a salt of L-lysine and orotic acid that can potentiate the toxicity of an extract of the mushroom Amanita phalloides[1]. |
| Name | MFCD03936118 |
|---|---|
| Synonym | More Synonyms |
| Description | L-Lysine orotate is a salt of L-lysine and orotic acid that can potentiate the toxicity of an extract of the mushroom Amanita phalloides[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H18N4O6 |
|---|---|
| Molecular Weight | 302.284 |
| Exact Mass | 302.122620 |
| InChIKey | FVGJURXBWORGKL-JEDNCBNOSA-N |
| SMILES | NCCCCC(N)C(=O)O.O=C(O)c1cc(=O)[nH]c(=O)[nH]1 |
| 2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid - L-lysine (1:1) |
| 2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid - L-lysine (1:1) |
| L-LYSINE OROTATE SALT |
| Lysine orotate |
| EINECS 248-771-4 |
| 2,6-dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid compound with (2S)-2,6-diaminohexanoic acid (1:1) |
| MFCD03936118 |
| 4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, compd. with L-lysine (1:1) |