8-[(Diethylamino)methyl]-2-(dimethylamino)-3,7-dihydro-3,7-dimethyl-6H-purin-6-one
Modify Date: 2025-09-22 17:06:47
![8-[(Diethylamino)methyl]-2-(dimethylamino)-3,7-dihydro-3,7-dimethyl-6H-purin-6-one Structure](https://image.chemsrc.com/caspic/202/27979-68-6.png)
8-[(Diethylamino)methyl]-2-(dimethylamino)-3,7-dihydro-3,7-dimethyl-6H-purin-6-one structure
|
Common Name | 8-[(Diethylamino)methyl]-2-(dimethylamino)-3,7-dihydro-3,7-dimethyl-6H-purin-6-one | ||
|---|---|---|---|---|
| CAS Number | 27979-68-6 | Molecular Weight | 292.38000 | |
| Density | 1.19g/cm3 | Boiling Point | 452.1ºC at 760mmHg | |
| Molecular Formula | C14H24N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.2ºC | |
| Name | 8-(diethylaminomethyl)-2-(dimethylamino)-3,7-dimethylpurin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 452.1ºC at 760mmHg |
| Molecular Formula | C14H24N6O |
| Molecular Weight | 292.38000 |
| Flash Point | 227.2ºC |
| Exact Mass | 292.20100 |
| PSA | 59.19000 |
| LogP | 0.57480 |
| Vapour Pressure | 2.3E-08mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | HGUVJZOEEGJSOL-UHFFFAOYSA-N |
| SMILES | CCN(CC)Cc1nc2c(c(=O)nc(N(C)C)n2C)n1C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-(diethylamino-methyl)-2-dimethylamino-3,7-dimethyl-3,7-dihydro-purin-6-one |
| 8-Diethylaminoethyl-3,7-dimethyl-2-dimethylaminohypoxanthine |
| 8-[(diethylamino)methyl]-2-(dimethylamino)-3,7-dimethyl-3,7-dihydro-6h-purin-6-one |
| Purin-6(3H)-one,8-diethylaminomethyl-3,7-dimethyl-2-dimethylamino |