8-[(Diethylamino)methyl]-2-ethoxy-3,7-dihydro-3,7-dimethyl-6H-purin-6-one
Modify Date: 2025-09-18 12:57:25
![8-[(Diethylamino)methyl]-2-ethoxy-3,7-dihydro-3,7-dimethyl-6H-purin-6-one Structure](https://image.chemsrc.com/caspic/240/27979-67-5.png)
8-[(Diethylamino)methyl]-2-ethoxy-3,7-dihydro-3,7-dimethyl-6H-purin-6-one structure
|
Common Name | 8-[(Diethylamino)methyl]-2-ethoxy-3,7-dihydro-3,7-dimethyl-6H-purin-6-one | ||
|---|---|---|---|---|
| CAS Number | 27979-67-5 | Molecular Weight | 293.36500 | |
| Density | 1.21g/cm3 | Boiling Point | 447.1ºC at 760 mmHg | |
| Molecular Formula | C14H23N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.2ºC | |
| Name | 8-(diethylaminomethyl)-2-ethoxy-3,7-dimethylpurin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 447.1ºC at 760 mmHg |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.36500 |
| Flash Point | 224.2ºC |
| Exact Mass | 293.18500 |
| PSA | 65.18000 |
| LogP | 0.90750 |
| Vapour Pressure | 3.45E-08mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | GOJRLLRYSLLIOI-UHFFFAOYSA-N |
| SMILES | CCOc1nc(=O)c2c(nc(CN(CC)CC)n2C)n1C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-[(diethylamino)methyl]-2-ethoxy-3,7-dimethyl-3,7-dihydro-6h-purin-6-one |
| Purin-6(3H)-one,8-diethylaminomethyl-3,7-dimethyl-2-ethoxy |
| 8-Diethylaminomethyl-3,7-dimethyl-2-ethoxyhypoxanthine |
| 8-(diethylamino-methyl)-2-ethoxy-3,7-dimethyl-3,7-dihydro-purin-6-one |