Imidazo[1,2-a]pyrazin-3(7H)-one,2-phenyl- structure
|
Common Name | Imidazo[1,2-a]pyrazin-3(7H)-one,2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 27955-58-4 | Molecular Weight | 211.21900 | |
| Density | 1.33g/cm3 | Boiling Point | 319.9ºC at 760mmHg | |
| Molecular Formula | C12H9N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.3ºC | |
| Name | 2-phenyl-7H-imidazo[1,2-a]pyrazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 319.9ºC at 760mmHg |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.21900 |
| Flash Point | 147.3ºC |
| Exact Mass | 211.07500 |
| PSA | 50.16000 |
| LogP | 1.68960 |
| Vapour Pressure | 0.000328mmHg at 25°C |
| Index of Refraction | 1.702 |
| InChIKey | JKXUCFWIJZSEIS-UHFFFAOYSA-N |
| SMILES | Oc1c(-c2ccccc2)nc2cnccn12 |
| HS Code | 2933990090 |
|---|
|
~99%
Imidazo[1,2-a]p... CAS#:27955-58-4 |
| Literature: Alcaide, Benito; Plumet, Joaquin; Sierra, Miguel A.; Vicent, Cristina Journal of Organic Chemistry, 1989 , vol. 54, # 24 p. 5763 - 5768 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Phenylimidazo[1,2-a]pyrazin-3(7H)-one |
| 2-phenyl-3,7-dihydroimidazo[1,2-a]pyrazin-3-one |
| 3,7-Dihydro-2-phenylimidazo<1,2-a>pyrazin-3-on |
| 2-Phenyl-3,7-dihydroimidazo<1.2-a>pyrazinon-(3) |