6-methyl-4-phenyl-1H-pyrimidine-2-thione structure
|
Common Name | 6-methyl-4-phenyl-1H-pyrimidine-2-thione | ||
|---|---|---|---|---|
| CAS Number | 27955-44-8 | Molecular Weight | 202.27500 | |
| Density | 1.19g/cm3 | Boiling Point | 320.5ºC at 760mmHg | |
| Molecular Formula | C11H10N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.6ºC | |
| Name | 6-methyl-4-phenyl-1H-pyrimidine-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 320.5ºC at 760mmHg |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.27500 |
| Flash Point | 147.6ºC |
| Exact Mass | 202.05600 |
| PSA | 64.58000 |
| LogP | 2.74070 |
| Vapour Pressure | 0.000317mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | LWQVDRQQNNUJRO-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccccc2)nc(=S)[nH]1 |
|
~71%
6-methyl-4-phen... CAS#:27955-44-8 |
| Literature: Katoh, Akira; Kashima, Choji; Omote, Yoshimori Heterocycles, 1982 , vol. 19, # 12 p. 2283 - 2286 |
|
~77%
6-methyl-4-phen... CAS#:27955-44-8 |
| Literature: Goswami, Shyamaprosad; Jana, Subrata; Dey, Swapan; Kumar Adak, Avijit Australian Journal of Chemistry, 2007 , vol. 60, # 2 p. 120 - 123 |
| 4-methyl-6-phenylpyrimidine-2-thiol |
| Pyrimidinthion |
| 2-mercapto-4-methyl-6-phenylpyrimidine |