1,1-dimethyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]urea structure
|
Common Name | 1,1-dimethyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]urea | ||
|---|---|---|---|---|
| CAS Number | 27954-37-6 | Molecular Weight | 280.21900 | |
| Density | 1.34g/cm3 | Boiling Point | 361.8ºC at 760mmHg | |
| Molecular Formula | C11H12F4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.6ºC | |
| Name | tetrafluron |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 361.8ºC at 760mmHg |
| Molecular Formula | C11H12F4N2O2 |
| Molecular Weight | 280.21900 |
| Flash Point | 172.6ºC |
| Exact Mass | 280.08300 |
| PSA | 45.06000 |
| LogP | 3.03040 |
| Vapour Pressure | 2.02E-05mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | FCAKZZMVXCLLHM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Nc1cccc(OC(F)(F)C(F)F)c1 |
| HS Code | 2924299090 |
|---|
|
~%
1,1-dimethyl-3-... CAS#:27954-37-6 |
| Literature: Hoechst AG Patent: US4013452 , 1977 ; Chem.Abstr., 1977 , vol. 87, # 5675 |
|
~%
1,1-dimethyl-3-... CAS#:27954-37-6 |
| Literature: Hoechst Patent: US3937726 , 1976 ; Chem.Abstr., 1976 , vol. 85, # 192415 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,1-dimethyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]urea |
| 3-(3-[1',1',2',2'-tetrafluoroethoxy]phenyl)-1,1-dimethylurea |
| 1,1-Dimethyl-3-(3-(1,1,2,2-tetrafluoroethoxy)phenyl)urea |
| Tetrafluron [ANSI:ISO] |
| Tetrafluoron |
| EINECS 248-746-8 |
| N,N-dimethyl-N’-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]urea |
| HOE-2991 |
| Tetrafluron [ANSI] |
| N'-(3-Tetrafluoroethoxyphenyl)-N,N-dimethylurea |
| Tomilon |