2-(4-Fluorophenoxy)benzoic acid
Modify Date: 2025-08-25 16:19:05
2-(4-Fluorophenoxy)benzoic acid structure
|
Common Name | 2-(4-Fluorophenoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2795-63-3 | Molecular Weight | 232.207 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 340.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C13H9FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.8±23.7 °C | |
| Name | 2-(4-Fluorophenoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 340.6±27.0 °C at 760 mmHg |
| Molecular Formula | C13H9FO3 |
| Molecular Weight | 232.207 |
| Flash Point | 159.8±23.7 °C |
| Exact Mass | 232.053574 |
| PSA | 46.53000 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | WRWUSRADWXKZGV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Oc1ccc(F)cc1 |
| Storage condition | 2-8°C |
|
~95%
2-(4-Fluorophen... CAS#:2795-63-3 |
| Literature: Wang, Congyang; Piel, Isabel; Glorius, Frank Journal of the American Chemical Society, 2009 , vol. 131, p. 4194 - 4195 |
|
~%
2-(4-Fluorophen... CAS#:2795-63-3 |
| Literature: SANOFI-AVENTIS Patent: US2006/293365 A1, 2006 ; Location in patent: Page/Page column 6 ; |
|
~%
2-(4-Fluorophen... CAS#:2795-63-3 |
| Literature: Mao, Mao; Wu, Qing-Qing; Ren, Ming-Guang; Song, Qin-Hua Organic and Biomolecular Chemistry, 2011 , vol. 9, # 9 p. 3165 - 3169 |
![2-fluorodibenzo[b,d]furan structure](https://image.chemsrc.com/caspic/455/391-46-8.png)
CAS#:391-46-8
CAS#:330-84-7
CAS#:2839-49-8| Benzoic acid, 2-(4-fluorophenoxy)- |
| BEN681 |
| 2-(4-Fluor-phenoxy)-benzoesaeure |
| 2-(4-Fluoro-phenoxy)-benzoic acid |
| 2-(4-Fluorophenoxy)benzoic acid |
| 2PBD-Q05-0 |
| AR1181 |