2-(4-aminophenyl)-N-(1-phenylpropan-2-yl)acetamide
Modify Date: 2025-09-23 11:22:23
2-(4-aminophenyl)-N-(1-phenylpropan-2-yl)acetamide structure
|
Common Name | 2-(4-aminophenyl)-N-(1-phenylpropan-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 2792-95-2 | Molecular Weight | 268.35400 | |
| Density | 1.113g/cm3 | Boiling Point | 519.2ºC at 760 mmHg | |
| Molecular Formula | C17H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.8ºC | |
| Name | 2-(4-aminophenyl)-N-(1-phenylpropan-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 519.2ºC at 760 mmHg |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.35400 |
| Flash Point | 267.8ºC |
| Exact Mass | 268.15800 |
| PSA | 58.61000 |
| LogP | 3.98020 |
| Vapour Pressure | 6.95E-11mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | GMFDXWRIUBOPIY-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccccc1)NC(=O)Cc1ccc(N)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Fepracet |
| (+-)-N-(p-Aminophenylacetyl)-1-benzylaethylamin |
| IEM 366 |
| Benzeneacetamide,4-amino-N-(1-methyl-2-phenylethyl) |
| Fepratset |
| 4-Amino-phenylessigsaeure-<1-methyl-2-phenylethylamid>Phepracet |