Solvent Yellow 157
Modify Date: 2025-08-21 10:50:02
Solvent Yellow 157 structure
|
Common Name | Solvent Yellow 157 | ||
|---|---|---|---|---|
| CAS Number | 27908-75-4 | Molecular Weight | 411.066 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 624.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C18H7Cl4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.3±31.5 °C | |
| Name | 4,5,6,7-Tetrachloro-2-(2-quinolinyl)-1H-indene-1,3(2H)-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 624.2±55.0 °C at 760 mmHg |
| Molecular Formula | C18H7Cl4NO2 |
| Molecular Weight | 411.066 |
| Flash Point | 331.3±31.5 °C |
| Exact Mass | 408.923096 |
| PSA | 47.03000 |
| LogP | 5.96 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.716 |
| InChIKey | FTQURCYYMGCGDB-UHFFFAOYSA-N |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)C1c1ccc2ccccc2n1 |
| HS Code | 2933499090 |
|---|
|
~91%
Solvent Yellow 157 CAS#:27908-75-4 |
| Literature: TOYO INK MFG. CO., LTD. Patent: EP1702960 A2, 2006 ; Location in patent: Page/Page column 17-18 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5,6,7-Tetrachlor-2,3-dihydro-1H-isoindol-1-on |
| 4,5,6,7-Tetrachloro-2-(quinolin-2-yl)-1H-indene-1,3(2H)-dione |
| 1H-Indene-1,3(2H)-dione, 4,5,6,7-tetrachloro-2-(2-quinolinyl)- |
| 4,5,6,7-Tetrachlorchinophthalon |
| 4,5,6,7-Tetrachloro-2-(2-quinolinyl)-1H-indene-1,3(2H)-dione |
| 1H-Isoindol-1-one,4,5,6,7-tetrachloro-2,3-dihydro |