1-methyl-2-[(E)-2-phenylethenyl]-2H-pyridine structure
|
Common Name | 1-methyl-2-[(E)-2-phenylethenyl]-2H-pyridine | ||
|---|---|---|---|---|
| CAS Number | 2787-08-8 | Molecular Weight | 323.17200 | |
| Density | 1.082g/cm3 | Boiling Point | 326.9ºC at 760mmHg | |
| Molecular Formula | C14H14IN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.6ºC | |
| Name | 1-methyl-2-styrylbenzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.082g/cm3 |
|---|---|
| Boiling Point | 326.9ºC at 760mmHg |
| Molecular Formula | C14H14IN |
| Molecular Weight | 323.17200 |
| Flash Point | 137.6ºC |
| Exact Mass | 323.01700 |
| PSA | 3.88000 |
| Vapour Pressure | 0.000209mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | SBVSJILKYJKCMX-ASTDGNLGSA-M |
| SMILES | C[n+]1ccccc1C=Cc1ccccc1.[I-] |
| HS Code | 2933399090 |
|---|
|
~%
1-methyl-2-[(E)... CAS#:2787-08-8 |
| Literature: Zhu, Baocun; Zhang, Xiaoling; Jia, Hongying; Li, Yamin; Chen, Shutang; Zhang, Sichun Dyes and Pigments, 2010 , vol. 86, # 1 p. 87 - 92 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-methyl-2-styryl-1H-benzoimidazole |
| N-methyl-2-styrylpyridinium iodide |
| 1-Methyl-2-styryl-pyridinium-jodid |
| N-Methyl-2-styrylpyridiniumiodid |