Benzamide,4-methoxy-N-(4-methoxyphenyl)- structure
|
Common Name | Benzamide,4-methoxy-N-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 27865-44-7 | Molecular Weight | 257.28400 | |
| Density | 1.189g/cm3 | Boiling Point | 340.8ºC at 760 mmHg | |
| Molecular Formula | C15H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.9ºC | |
| Name | 4-methoxy-N-(4-methoxyphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 340.8ºC at 760 mmHg |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.28400 |
| Flash Point | 159.9ºC |
| Exact Mass | 257.10500 |
| PSA | 47.56000 |
| LogP | 3.02910 |
| Vapour Pressure | 8.38E-05mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | QHJITBHWXMRQAX-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)c2ccc(OC)cc2)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-dimethoxybenzanilide |
| p-Anis-p-anisidide |