[2,2'-Binaphthalene]-8,8'-dicarboxaldehyde,1,1',6,6',7,7'-hexamethoxy-3,3'-dimethyl-5,5'-bis(1-methylethyl)- structure
|
Common Name | [2,2'-Binaphthalene]-8,8'-dicarboxaldehyde,1,1',6,6',7,7'-hexamethoxy-3,3'-dimethyl-5,5'-bis(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 27864-29-5 | Molecular Weight | 602.71400 | |
| Density | 1.152g/cm3 | Boiling Point | 709.3ºC at 760 mmHg | |
| Molecular Formula | C36H42O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.1ºC | |
| Name | 7-(8-formyl-1,6,7-trimethoxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trimethoxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 709.3ºC at 760 mmHg |
| Molecular Formula | C36H42O8 |
| Molecular Weight | 602.71400 |
| Flash Point | 291.1ºC |
| Exact Mass | 602.28800 |
| PSA | 89.52000 |
| LogP | 8.20020 |
| Vapour Pressure | 5.75E-20mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | UBNXLZMXWUQSCB-UHFFFAOYSA-N |
| SMILES | COc1c(OC)c(C=O)c2c(OC)c(-c3c(C)cc4c(C(C)C)c(OC)c(OC)c(C=O)c4c3OC)c(C)cc2c1C(C)C |
| Hexa-O-methyl-thespesin |
| (+-)-Gossypol-hexamethylether |
| 8,8'-Diformyl-5,5'-diisopropyl-1,1',6,6',7,7'-hexamethoxy-3,3'-dimethyl-2,2'-binaphthalene |
| 5,5'-diisopropyl-1,1',6,6',7,7'-hexamethoxy-3,3'-dimethyl-2,2'-binaphthalene-8,8'-dicarbaldehyde |
| dialdehyde form of gossypol hexamethyl ether |