benzhydryl selenocyanate
Modify Date: 2024-01-09 19:50:24
benzhydryl selenocyanate structure
|
Common Name | benzhydryl selenocyanate | ||
|---|---|---|---|---|
| CAS Number | 27805-30-7 | Molecular Weight | 272.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NSe | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzhydryl selenocyanate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11NSe |
|---|---|
| Molecular Weight | 272.20400 |
| Exact Mass | 273.00600 |
| PSA | 23.79000 |
| LogP | 3.05678 |
| InChIKey | RNAKAYCVSPMHHK-UHFFFAOYSA-N |
| SMILES | N#C[Se]C(c1ccccc1)c1ccccc1 |
|
~86%
benzhydryl sele... CAS#:27805-30-7 |
| Literature: Meinke, Peter T.; Krafft, Grant A. Journal of the American Chemical Society, 1988 , vol. 110, # 26 p. 8679 - 8685 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzhydrylselenocyanat |
| Selenocyanic acid,diphenylmethyl ester |
| diphenylmethyl selenocyanate |
| Diphenylmethylselenocyanat |