4-(Trimethylsiloxy)benzoic acid methyl ester structure
|
Common Name | 4-(Trimethylsiloxy)benzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 27739-17-9 | Molecular Weight | 224.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methoxycarbonylphenoxy)trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H16O3Si |
|---|---|
| Molecular Weight | 224.32800 |
| Exact Mass | 224.08700 |
| PSA | 35.53000 |
| LogP | 2.68690 |
| InChIKey | UGFXQBRWNPEHCX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(O[Si](C)(C)C)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| p-Carbomethoxyphenyl-trimethylsilylaether |
| methyl 4-trimethylsiloxybenzoate |
| p-Hydroxybenzoesaeuremethylestertrimethylsilylaether |
| 4-(Trimethylsilyloxy)-benzoesaeuremethylester |