oleic acid, compound with ethane-1,2-diamine structure
|
Common Name | oleic acid, compound with ethane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 27738-73-4 | Molecular Weight | 342.56000 | |
| Density | N/A | Boiling Point | 360ºC at 760 mmHg | |
| Molecular Formula | C20H42N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.1ºC | |
| Name | ethane-1,2-diamine,octadec-9-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 360ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H42N2O2 |
| Molecular Weight | 342.56000 |
| Flash Point | 270.1ºC |
| Exact Mass | 342.32500 |
| PSA | 89.34000 |
| LogP | 6.41290 |
| Vapour Pressure | 3.7E-06mmHg at 25°C |
| InChIKey | WODXGCGEKYXYEZ-KVVVOXFISA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O.NCCN |
| Aethylendiamin,Dioleat |
| compound with ethane-1,2-diamine |
| ethylenediamine,dioleate |
| Oleic acid,compound with ethane-1,2-diamine |