2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine
Modify Date: 2025-10-13 13:49:36
![2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine Structure](https://www.chemsrc.com/extcaspic/034/2770582-58-4.png)
2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine structure
|
Common Name | 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine | ||
|---|---|---|---|---|
| CAS Number | 2770582-58-4 | Molecular Weight | 362.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H20BrN3O |
|---|---|
| Molecular Weight | 362.3 |
| InChIKey | IUCMVLHEXIKAHS-UHFFFAOYSA-N |
| SMILES | Brc1ccc(CN2CCCC(COc3cnccn3)C2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine? |
| A: SMILES notation of 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine is Brc1ccc(CN2CCCC(COc3cnccn3)C2)cc1. |
| Q: What is the InChIKey of 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine? |
| A: InChIKey of 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine is IUCMVLHEXIKAHS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine? |
| A: Molecular formula of 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine is C17H20BrN3O. |
| Q: What is the Chinese name of 2770582-58-4? |
| A: Chinese name of 2770582-58-4 is 2770582-58-4. |
| Q: What is the English name of 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine? |
| A: The English name of 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine is 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine. |
| Q: What is the CAS number of 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine? |
| A: CAS number of 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine is 2770582-58-4. |
| Q: What is the molecular weight of 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine? |
| A: Molecular weight of 2-({1-[(4-Bromophenyl)methyl]piperidin-3-yl}methoxy)pyrazine is 362.3. |