Iroxanadine sulfate
Modify Date: 2024-04-08 18:06:30
Iroxanadine sulfate structure
|
Common Name | Iroxanadine sulfate | ||
|---|---|---|---|---|
| CAS Number | 276690-61-0 | Molecular Weight | 358.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Iroxanadine sulfateIroxanadine sulfate is a MAPK p38 inhibitor potentially for the treatment of atherosclerosis. |
| Name | Iroxanadine sulfate |
|---|
| Description | Iroxanadine sulfate is a MAPK p38 inhibitor potentially for the treatment of atherosclerosis. |
|---|
| Molecular Formula | C14H22N4O5S |
|---|---|
| Molecular Weight | 358.41 |
| InChIKey | KRDJXQILWJDTAQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)O.c1cncc(C2=NC(CN3CCCCC3)CON2)c1 |