tert-Butyl 6-chloro-3,5-dioxohexanoate structure
|
Common Name | tert-Butyl 6-chloro-3,5-dioxohexanoate | ||
|---|---|---|---|---|
| CAS Number | 276249-18-4 | Molecular Weight | 234.677 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 301.3±22.0 °C at 760 mmHg | |
| Molecular Formula | C10H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.3±21.3 °C | |
| Name | tert-butyl 6-chloro-3,5-dioxohexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.3±22.0 °C at 760 mmHg |
| Molecular Formula | C10H15ClO4 |
| Molecular Weight | 234.677 |
| Flash Point | 116.3±21.3 °C |
| Exact Mass | 234.065887 |
| PSA | 60.44000 |
| LogP | 3.27 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | YNYSBGCKDNJMLE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(=O)CC(=O)CCl |
| HS Code | 2918300090 |
|---|
|
~97%
tert-Butyl 6-ch... CAS#:276249-18-4 |
| Literature: LONZA LTD; NOTI, Christian; HU, Guixian; JACKSON, Barry Patent: WO2012/130919 A1, 2012 ; Location in patent: Page/Page column 24 ; |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 6-Chloro-3,5-dioxo hexanic acid,1,1-dimethyl ethyl ester |
| 6-chloro-3,5-dioxohexanoic acid tert-butyl ester |
| tert-Butyl 6-chloro-3,5-dioxohexanoate |
| 1,1-Dimethylethyl6-chloro-3,5-dioxohexanoate |
| 6-Chloro-3,5-dioxo hexanic acid, 1,1-dimethyl ethyl ester |
| Hexanoic acid, 6-chloro-3,5-dioxo-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 6-chloro-3,5-dioxohexanoate |
| 6-CHLORO-3,5-DIOXO-HEXANIC ACID TERT-BUTYL ESTER |