3-amino-6-chloro-4-phenylquinazolin-4-ol structure
|
Common Name | 3-amino-6-chloro-4-phenylquinazolin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 27610-14-6 | Molecular Weight | 273.71800 | |
| Density | 1.39g/cm3 | Boiling Point | 498.6ºC at 760mmHg | |
| Molecular Formula | C14H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.4ºC | |
| Name | 3-amino-6-chloro-4-phenylquinazolin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 498.6ºC at 760mmHg |
| Molecular Formula | C14H12ClN3O |
| Molecular Weight | 273.71800 |
| Flash Point | 255.4ºC |
| Exact Mass | 273.06700 |
| PSA | 61.85000 |
| LogP | 2.45630 |
| Vapour Pressure | 9.23E-11mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | ZAXFFQSOWYVGER-UHFFFAOYSA-N |
| SMILES | NN1C=Nc2ccc(Cl)cc2C1(O)c1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~97%
3-amino-6-chlor... CAS#:27610-14-6 |
| Literature: Takeda Chemical Industries, Ltd. Patent: US4082764 A1, 1978 ; |
|
~%
3-amino-6-chlor... CAS#:27610-14-6 |
| Literature: Hirai; Fujishita; Ishiba; Sugimoto; Matsutani; Tsukinoki; Hirose Journal of Medicinal Chemistry, 1982 , vol. 25, # 12 p. 1466 - 1473 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Amino-6-chloro-3,4-dihydro-4-phenylquinazolin-4-ol |
| 3-amino-6-chloro-4-phenyl-3,4-dihydroquinazolin-4-ol |
| 3-amino-6-chloro-3,4-dihydro-4-hydroxy-4-phenylquinazoline |
| 3-Amino-6-chlor-4-hydroxy-4-phenyl-3,4-dihydrochinazolin |