3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononanesulphonyl chloride
Modify Date: 2025-11-26 00:15:27
3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononanesulphonyl chloride structure
|
Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononanesulphonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 27607-61-0 | Molecular Weight | 496.62100 | |
| Density | 1.703g/cm3 | Boiling Point | 252.4ºC at 760mmHg | |
| Molecular Formula | C9H4ClF15O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.5ºC | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononane-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.703g/cm3 |
|---|---|
| Boiling Point | 252.4ºC at 760mmHg |
| Molecular Formula | C9H4ClF15O2S |
| Molecular Weight | 496.62100 |
| Flash Point | 106.5ºC |
| Exact Mass | 495.93800 |
| PSA | 42.52000 |
| LogP | 6.40000 |
| Vapour Pressure | 0.0308mmHg at 25°C |
| Index of Refraction | 1.328 |
| InChIKey | CBCLHIUXUOXITK-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Pentadecafluorononanesulphonyl chloride |
| 2-(Perfluoroheptyl)ethanesulfonylchloride |
| EINECS 248-564-9 |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononanesulfonyl chloride |