Tirfipiravir structure
|
Common Name | Tirfipiravir | ||
|---|---|---|---|---|
| CAS Number | 2759996-93-3 | Molecular Weight | 355.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TirfipiravirTirfipiravir is a nucleoside compound and antiviral agent, against the novel coronavirus or influenza virus[1]. |
| Name | Tirfipiravir |
|---|
| Description | Tirfipiravir is a nucleoside compound and antiviral agent, against the novel coronavirus or influenza virus[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C14H17N3O8 |
|---|---|
| Molecular Weight | 355.30 |
| InChIKey | KDWNZFQMGWEBAL-QCNRFFRDSA-N |
| SMILES | CC(C)C(=O)OCC1OC(n2ccc(NO)nc2=O)C2OC(=O)OC12 |