Ibuzatrelvir structure
|
Common Name | Ibuzatrelvir | ||
|---|---|---|---|---|
| CAS Number | 2755812-39-4 | Molecular Weight | 489.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30F3N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IbuzatrelvirIbuzatrelvir (PF-07817883) is an antiviral agent, targeting to SARS-CoV-2 3CL protease. Ibuzatrelvir can be used to inhibit COVID-19[1]. |
| Name | Ibuzatrelvir |
|---|
| Description | Ibuzatrelvir (PF-07817883) is an antiviral agent, targeting to SARS-CoV-2 3CL protease. Ibuzatrelvir can be used to inhibit COVID-19[1]. |
|---|---|
| Related Catalog | |
| Target |
SARS-CoV-2 3CL protease, COVID-19[1] |
| References |
| Molecular Formula | C21H30F3N5O5 |
|---|---|
| Molecular Weight | 489.49 |
| InChIKey | WGNWEPPRWQKSKI-AIEDFZFUSA-N |
| SMILES | COC(=O)NC(C(=O)N1CC(C(F)(F)F)CC1C(=O)NC(C#N)CC1CCNC1=O)C(C)(C)C |