m-[1-(p-Hydroxyphenethyl)-3-propyl-3-pyrrolidinyl]phenol structure
|
Common Name | m-[1-(p-Hydroxyphenethyl)-3-propyl-3-pyrrolidinyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 27544-75-8 | Molecular Weight | 325.44500 | |
| Density | 1.116g/cm3 | Boiling Point | 499.7ºC at 760mmHg | |
| Molecular Formula | C21H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.3ºC | |
| Name | 3-[1-[2-(4-hydroxyphenyl)ethyl]-3-propylpyrrolidin-3-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 499.7ºC at 760mmHg |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.44500 |
| Flash Point | 254.3ºC |
| Exact Mass | 325.20400 |
| PSA | 43.70000 |
| LogP | 4.02200 |
| Vapour Pressure | 1.32E-10mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | LRMYMYHAGWQOEO-UHFFFAOYSA-N |
| SMILES | CCCC1(c2cccc(O)c2)CCN(CCc2ccc(O)cc2)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrrolidine,1-(p-hydroxyphenethyl)-3-(m-hydroxyphenyl)-3-propyl |
| 3-(1-(p-Hydroxyphenethyl)-3-propyl-3-pyrrolidinyl)phenol |
| 3-[1-(4-hydroxy-phenethyl)-3-propyl-pyrrolidin-3-yl]-phenol |
| Phenol,m-(1-(p-hydroxyphenethyl)-3-propyl-3-pyrrolidinyl) |