Tamarixin structure
|
Common Name | Tamarixin | ||
|---|---|---|---|---|
| CAS Number | 27542-39-8 | Molecular Weight | 478.396 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TamarixinTamarixin is flavonoid that isolated from Astragalus tanae Sosn that has hepatoprotective, antioxidant, anticancer, and antimicrobial activities[1]. |
| Name | 2-(3-Hydroxy-4-methoxyphenyl)-3-(β-D-glucopyranosyloxy)-5,7-dihydroxy-4H-1-benzopyran-4-one |
|---|
| Description | Tamarixin is flavonoid that isolated from Astragalus tanae Sosn that has hepatoprotective, antioxidant, anticancer, and antimicrobial activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H22O12 |
|---|---|
| Molecular Weight | 478.396 |
| InChIKey | JXASPPWQHFOWPL-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2OC2OC(CO)C(O)C(O)C2O)cc1O |
| Storage condition | 2-8℃ |