Methanesulfonamide,N,N'-[1,2-bis(hydroxymethyl)ethylene]bis-, dimethanesulfonate (ester), meso-(8CI) structure
|
Common Name | Methanesulfonamide,N,N'-[1,2-bis(hydroxymethyl)ethylene]bis-, dimethanesulfonate (ester), meso-(8CI) | ||
|---|---|---|---|---|
| CAS Number | 27511-50-8 | Molecular Weight | 432.51200 | |
| Density | 1.568g/cm3 | Boiling Point | 720.5ºC at 760mmHg | |
| Molecular Formula | C8H20N2O10S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 389.6ºC | |
| Name | [2,3-bis(methanesulfonamido)-4-methylsulfonyloxybutyl] methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.568g/cm3 |
|---|---|
| Boiling Point | 720.5ºC at 760mmHg |
| Molecular Formula | C8H20N2O10S4 |
| Molecular Weight | 432.51200 |
| Flash Point | 389.6ºC |
| Exact Mass | 432.00000 |
| PSA | 212.60000 |
| LogP | 1.87940 |
| Vapour Pressure | 1.3E-20mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | HUGXNNOHHJYMRV-OCAPTIKFSA-N |
| SMILES | CS(=O)(=O)NC(COS(C)(=O)=O)C(COS(C)(=O)=O)NS(C)(=O)=O |
|
~%
Methanesulfonam... CAS#:27511-50-8 |
| Literature: Feit,P.W.; Nielsen,O.T. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 447 - 452 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,2-DI-1-NAPHTHYLETHANE-1,2-DIAMINE |
| meso-1,4-Dimethan-sulfonyloxy-2,3-dimethan-sulfonamidobutan |