Resigratinib structure
|
Common Name | Resigratinib | ||
|---|---|---|---|---|
| CAS Number | 2750709-91-0 | Molecular Weight | 523.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H27F2N7O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ResigratinibResigratinib (KIN-3248) is a FGFR tyrosine kinase inhibitor, with antineoplastic effect[1]. |
| Name | Resigratinib |
|---|
| Description | Resigratinib (KIN-3248) is a FGFR tyrosine kinase inhibitor, with antineoplastic effect[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H27F2N7O3 |
|---|---|
| Molecular Weight | 523.53 |
| InChIKey | YXVDEILMUVTDMK-JKSUJKDBSA-N |
| SMILES | C=CC(=O)N1CC(n2nc(C#Cc3c(F)cc4c(ncn4C4CC4)c3F)c(C(N)=O)c2NC)CC1COC |