3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid
Modify Date: 2025-09-04 18:13:31
![3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid Structure](https://www.chemsrc.com/extcaspic/087/2748247-03-0.png)
3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid structure
|
Common Name | 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2748247-03-0 | Molecular Weight | 261.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N3O3 |
|---|---|
| Molecular Weight | 261.28 |
| InChIKey | OJACQSCZAHEQFA-UHFFFAOYSA-N |
| SMILES | Cc1nnc(COc2ccccc2)n1CCC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid? |
| A: Molecular formula of 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid is C13H15N3O3. |
| Q: What is the Chinese name of 2748247-03-0? |
| A: Chinese name of 2748247-03-0 is 2748247-03-0. |
| Q: What is the molecular weight of 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid? |
| A: Molecular weight of 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid is 261.28. |
| Q: What is the CAS number of 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid? |
| A: CAS number of 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid is 2748247-03-0. |
| Q: What is the SMILES notation of 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid? |
| A: SMILES notation of 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid is Cc1nnc(COc2ccccc2)n1CCC(=O)O. |
| Q: What is the InChIKey of 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid? |
| A: InChIKey of 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid is OJACQSCZAHEQFA-UHFFFAOYSA-N. |
| Q: What is the English name of 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid? |
| A: The English name of 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid is 3-[3-methyl-5-(phenoxymethyl)-4H-1,2,4-triazol-4-yl]propanoic acid. |