Acetic acid m-[1-(p-acetoxyphenethyl)-3-propyl-3-pyrrolidinyl]phenyl ester
Modify Date: 2025-08-24 17:39:05
![Acetic acid m-[1-(p-acetoxyphenethyl)-3-propyl-3-pyrrolidinyl]phenyl ester Structure](https://image.chemsrc.com/caspic/379/27452-90-0.png)
Acetic acid m-[1-(p-acetoxyphenethyl)-3-propyl-3-pyrrolidinyl]phenyl ester structure
|
Common Name | Acetic acid m-[1-(p-acetoxyphenethyl)-3-propyl-3-pyrrolidinyl]phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 27452-90-0 | Molecular Weight | 409.51800 | |
| Density | 1.106g/cm3 | Boiling Point | 527.7ºC at 760 mmHg | |
| Molecular Formula | C25H31NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.9ºC | |
| Name | [4-[2-[3-(3-acetyloxyphenyl)-3-propylpyrrolidin-1-yl]ethyl]phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 527.7ºC at 760 mmHg |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.51800 |
| Flash Point | 272.9ºC |
| Exact Mass | 409.22500 |
| PSA | 55.84000 |
| LogP | 4.46140 |
| Vapour Pressure | 3.18E-11mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | TUZIOXPOHMWNKY-UHFFFAOYSA-N |
| SMILES | CCCC1(c2cccc(OC(C)=O)c2)CCN(CCc2ccc(OC(C)=O)cc2)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Phenol,3-(p-hydroxyphenethyl-3-propyl-3-pyrrolidinyl)-,diacetate |
| 1-(4-acetoxy-phenethyl)-3-(3-acetoxy-phenyl)-3-propyl-pyrrolidine |
| 3-(1-{2-[4-(acetyloxy)phenyl]ethyl}-3-propylpyrrolidin-3-yl)phenyl acetate |
| 3-(p-Acetyloxyphenethyl-3-propyl-3-pyrrolidinyl)phenol acetate |