PI3K-IN-27
Modify Date: 2025-09-21 14:50:30
PI3K-IN-27 structure
|
Common Name | PI3K-IN-27 | ||
|---|---|---|---|---|
| CAS Number | 2742654-38-0 | Molecular Weight | 572.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H26F2N6O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PI3K-IN-27PI3K-IN-27 is a potent inhibitor of PI3K. PI3K belongs to a large family of lipid signaling kinase that plays key role in cellular process including cell growth, differentiation, migration and apoptosis. PI3K-IN-27 has the potential for the research of hyper-proliferative diseases like cancer and inflammation, or immune and autoimmune diseases (extracted from patent WO2021233227A1, compound 1)[1]. |
| Name | PI3K-IN-27 |
|---|
| Description | PI3K-IN-27 is a potent inhibitor of PI3K. PI3K belongs to a large family of lipid signaling kinase that plays key role in cellular process including cell growth, differentiation, migration and apoptosis. PI3K-IN-27 has the potential for the research of hyper-proliferative diseases like cancer and inflammation, or immune and autoimmune diseases (extracted from patent WO2021233227A1, compound 1)[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Zuwen ZHOU, et al. Compounds as protein kinase inhibitors. Patent WO2021233227A1. |
| Molecular Formula | C30H26F2N6O2S |
|---|---|
| Molecular Weight | 572.63 |
| InChIKey | HELOTLHUKZIUKW-KRWDZBQOSA-N |
| SMILES | Cc1csc2cc(C(C)n3nc(-c4ccc(OC(C)C)c(F)c4)c4c(N)ncnc43)c(-c3cccc(F)c3)c(=O)n12 |