Diethyl 5-oxocyclooctane-1,1-dicarboxylate
Modify Date: 2025-09-14 18:00:12
Diethyl 5-oxocyclooctane-1,1-dicarboxylate structure
|
Common Name | Diethyl 5-oxocyclooctane-1,1-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 274255-51-5 | Molecular Weight | 270.32100 | |
| Density | 1.102g/cm3 | Boiling Point | 343.8ºC at 760mmHg | |
| Molecular Formula | C14H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.7ºC | |
| Name | Diethyl 5-oxocyclooctane-1,1-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 343.8ºC at 760mmHg |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32100 |
| Flash Point | 147.7ºC |
| Exact Mass | 270.14700 |
| PSA | 69.67000 |
| LogP | 2.02230 |
| Vapour Pressure | 6.88E-05mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | NFFLGTPLKLWJHA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCCC(=O)CCC1 |
| HS Code | 2918300090 |
|---|
|
~%
Diethyl 5-oxocy... CAS#:274255-51-5 |
| Literature: Tetrahedron Letters, , vol. 52, # 52 p. 7202 - 7205 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,1-diethyl 5-oxocyclooctane-1,1-dicarboxylate |
| Diethyl 5-oxo-1,1-cyclooctanedicarboxylate |