Hydrazinecarbothioamide,2-(diphenylmethylene)-N-methyl-
Modify Date: 2024-01-11 20:02:30
Hydrazinecarbothioamide,2-(diphenylmethylene)-N-methyl- structure
|
Common Name | Hydrazinecarbothioamide,2-(diphenylmethylene)-N-methyl- | ||
|---|---|---|---|---|
| CAS Number | 27421-66-5 | Molecular Weight | 269.36500 | |
| Density | 1.12g/cm3 | Boiling Point | 398.2ºC at 760mmHg | |
| Molecular Formula | C15H15N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.7ºC | |
| Name | 1-(benzhydrylideneamino)-3-methylthiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 398.2ºC at 760mmHg |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.36500 |
| Flash Point | 194.7ºC |
| Exact Mass | 269.09900 |
| PSA | 68.51000 |
| LogP | 3.31470 |
| Vapour Pressure | 1.5E-06mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | FUNWUXYFJVMZFJ-UHFFFAOYSA-N |
| SMILES | CNC(=S)NN=C(c1ccccc1)c1ccccc1 |
|
~%
Hydrazinecarbot... CAS#:27421-66-5 |
| Literature: Su, Wei; Qian, Quanquan; Li, Peiyuan; Lei, Xiaolin; Xiao, Qi; Huang, Shan; Huang, Chusheng; Cui, Jianguo Inorganic Chemistry, 2013 , vol. 52, # 21 p. 12440 - 12449 |
|
~%
Hydrazinecarbot... CAS#:27421-66-5 |
| Literature: Berg,C. Journal of the Chemical Society, Chemical Communications, 1974 , p. 122 - 123 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| benzophenone-N-methylthiosemicarbazone |