Cap-dependent endonuclease-IN-23 structure
|
Common Name | Cap-dependent endonuclease-IN-23 | ||
|---|---|---|---|---|
| CAS Number | 2741952-36-1 | Molecular Weight | 527.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H23F2N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cap-dependent endonuclease-IN-23Cap-dependent endonuclease-IN-23 is a potent inhibitor of cap-dependent endonuclease (CEN). Cap-dependent endonuclease-IN-23 inhibits the replication of influenza virus. ap-dependent endonuclease-IN-23 has the potential for the research of influenza virus infection (influenza A) (extracted from patent WO2021233302A1, compound 8A or 8B)[1]. |
| Name | Cap-dependent endonuclease-IN-23 |
|---|
| Description | Cap-dependent endonuclease-IN-23 is a potent inhibitor of cap-dependent endonuclease (CEN). Cap-dependent endonuclease-IN-23 inhibits the replication of influenza virus. ap-dependent endonuclease-IN-23 has the potential for the research of influenza virus infection (influenza A) (extracted from patent WO2021233302A1, compound 8A or 8B)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H23F2N3O7 |
|---|---|
| Molecular Weight | 527.47 |
| InChIKey | NKFNQBUTOXCBGL-YADHBBJMSA-N |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N1C(c3ccccc3)c3cc(F)c(F)cc3OCCC1N(C)C2=O |