bis(3-methylbut-2-enyl)-diphenylphosphanium,bromide
Modify Date: 2025-09-12 17:06:37
bis(3-methylbut-2-enyl)-diphenylphosphanium,bromide structure
|
Common Name | bis(3-methylbut-2-enyl)-diphenylphosphanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 27387-41-3 | Molecular Weight | 403.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28BrP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(3-methylbut-2-enyl)-diphenylphosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H28BrP |
|---|---|
| Molecular Weight | 403.33500 |
| Exact Mass | 402.11100 |
| PSA | 13.59000 |
| LogP | 2.59140 |
| InChIKey | YSNWDWYSLKVCOC-UHFFFAOYSA-M |
| SMILES | CC(C)=CC[P+](CC=C(C)C)(c1ccccc1)c1ccccc1.[Br-] |
|
~%
bis(3-methylbut... CAS#:27387-41-3 |
| Literature: Cristau, Henri-Jean; Ribeill, Yves Synthesis, 1988 , # 11 p. 911 - 912 |
|
~%
bis(3-methylbut... CAS#:27387-41-3 |
| Literature: Baldwin,J.E.; Armstrong,C.H. Journal of the Chemical Society [Section] D: Chemical Communications, 1970 , p. 631 - 632 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| diphenyldiprenylphosphonium bromide |
| bis(3-methyl-2-butenyl)siphenylphosphonium bromide |
| bis(3-methyl-2-butenyl)diphenylphosphonium bromide |
| Phosphonium,bis(3-methyl-2-butenyl)diphenyl-,bromide |