1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol
Modify Date: 2026-09-27 20:13:55
1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol structure
|
Common Name | 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol | ||
|---|---|---|---|---|
| CAS Number | 2734773-49-8 | Molecular Weight | 298.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11BrCl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11BrCl2O |
|---|---|
| Molecular Weight | 298.00 |
| InChIKey | KLLQIDYTFPEPSK-UHFFFAOYSA-N |
| SMILES | CCc1cc(Br)cc(C(O)C(Cl)Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol? |
| A: InChIKey of 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol is KLLQIDYTFPEPSK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol? |
| A: Molecular weight of 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol is 298.00. |
| Q: What is the Chinese name of 2734773-49-8? |
| A: Chinese name of 2734773-49-8 is 2734773-49-8. |
| Q: What is the English name of 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol? |
| A: The English name of 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol is 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol. |
| Q: What is the molecular formula of 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol? |
| A: Molecular formula of 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol is C10H11BrCl2O. |
| Q: What is the SMILES notation of 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol? |
| A: SMILES notation of 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol is CCc1cc(Br)cc(C(O)C(Cl)Cl)c1. |
| Q: What is the CAS number of 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol? |
| A: CAS number of 1-(3-Bromo-5-ethylphenyl)-2,2-dichloroethanol is 2734773-49-8. |