1,3,2-Dioxaphosphorinane-5-carboxylicacid, 2-hydroxy-5-methyl-, methyl ester, 2-oxide structure
|
Common Name | 1,3,2-Dioxaphosphorinane-5-carboxylicacid, 2-hydroxy-5-methyl-, methyl ester, 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 27315-41-9 | Molecular Weight | 210.12200 | |
| Density | 1.4g/cm3 | Boiling Point | 280.4ºC at 760mmHg | |
| Molecular Formula | C6H11O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.4ºC | |
| Name | methyl 2-hydroxy-5-methyl-2-oxo-1,3,2λ5-dioxaphosphinane-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 280.4ºC at 760mmHg |
| Molecular Formula | C6H11O6P |
| Molecular Weight | 210.12200 |
| Flash Point | 123.4ºC |
| Exact Mass | 210.02900 |
| PSA | 91.87000 |
| LogP | 0.31290 |
| Vapour Pressure | 0.00101mmHg at 25°C |
| Index of Refraction | 1.465 |
| InChIKey | DNXOOLXDGRVQKK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(C)COP(=O)(O)OC1 |
|
~%
1,3,2-Dioxaphos... CAS#:27315-41-9 |
| Literature: Billman; Roehrig Journal of pharmaceutical sciences, 1970 , vol. 59, # 6 p. 861 - 863 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,3,2-Dioxaphosphorinane-5-carboxylicacid,2-hydroxy-5-methyl-,methyl ester,2-oxide |
| methyl 2-hydroxy-5-methyl-1,3,2-dioxaphosphinane-5-carboxylate 2-oxide |