2,2'-Methylenebis(4-aminophenol) dihydrochloride
Modify Date: 2025-08-24 18:03:55
2,2'-Methylenebis(4-aminophenol) dihydrochloride structure
|
Common Name | 2,2'-Methylenebis(4-aminophenol) dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 27311-52-0 | Molecular Weight | 303.184 | |
| Density | N/A | Boiling Point | 554.7ºC at 760 mmHg | |
| Molecular Formula | C13H16Cl2N2O2 | Melting Point | >300°C | |
| MSDS | N/A | Flash Point | 289.3ºC | |
| Name | 4-amino-2-[(5-amino-2-hydroxyphenyl)methyl]phenol,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 554.7ºC at 760 mmHg |
|---|---|
| Melting Point | >300°C |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.184 |
| Flash Point | 289.3ºC |
| Exact Mass | 302.058868 |
| PSA | 92.50000 |
| LogP | 4.61940 |
| Vapour Pressure | 6.53E-13mmHg at 25°C |
| InChIKey | WKERZZAEPVPFPO-UHFFFAOYSA-N |
| SMILES | Cl.Cl.Nc1ccc(O)c(Cc2cc(N)ccc2O)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ZR DQ C1R CZ FQ &&2HCl |
| 2,2'-Methylenebis-4-aminophenol HCl |
| MFCD07368625 |
| UNII-NOJ4K5V5UH |
| Phenol, 2,2'-methylenebis[4-amino-, dihydrochloride |
| Bis-(5-amino-2-hydroxyphenyl)methane 2HCl |
| 2,2'-Methylenebis(4-aminophenol) dihydrochloride |
| Phenol, 2,2'-methylenebis[4-amino-, hydrochloride (1:2) |