3-(2,4-dichlorophenyl)-4,8b-dihydro-3aH-indeno[2,1-d][1,2]oxazole structure
|
Common Name | 3-(2,4-dichlorophenyl)-4,8b-dihydro-3aH-indeno[2,1-d][1,2]oxazole | ||
|---|---|---|---|---|
| CAS Number | 27271-38-1 | Molecular Weight | 304.17100 | |
| Density | 1.47g/cm3 | Boiling Point | 423.7ºC at 760 mmHg | |
| Molecular Formula | C16H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.1ºC | |
| Name | 3-(2,4-dichlorophenyl)-4,8b-dihydro-3aH-indeno[2,1-d][1,2]oxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 423.7ºC at 760 mmHg |
| Molecular Formula | C16H11Cl2NO |
| Molecular Weight | 304.17100 |
| Flash Point | 210.1ºC |
| Exact Mass | 303.02200 |
| PSA | 21.59000 |
| LogP | 4.07690 |
| Vapour Pressure | 5.39E-07mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | WQEIXXUAYRBKDU-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C2=NOC3c4ccccc4CC23)c(Cl)c1 |
|
~%
3-(2,4-dichloro... CAS#:27271-38-1 |
| Literature: Trepanier; Faith; Eble Journal of medicinal chemistry, 1970 , vol. 13, # 4 p. 729 - 733 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(2,4-dichloro-phenyl)-4,8b-dihydro-3aH-indeno[2,1-d]isoxazole |
| 3a,8b-Dihydro-3-(2,4-dichlorophenyl)-4H-indeno(2,1-d)isoxazole |
| 4H-Indeno(2,1-d)isoxazole,3a,8b-dihydro-3-(2,4-dichlorophenyl) |