5-BENZYL-4,5,6,7-TETRAHYDRO-1H-PYRROLO[3,2-C]PYRIDINE structure
|
Common Name | 5-BENZYL-4,5,6,7-TETRAHYDRO-1H-PYRROLO[3,2-C]PYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 272442-27-0 | Molecular Weight | 212.29000 | |
| Density | 1.154g/cm3 | Boiling Point | 364.6ºC at 760 mmHg | |
| Molecular Formula | C14H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.3ºC | |
| Name | 5-benzyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 364.6ºC at 760 mmHg |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.29000 |
| Flash Point | 174.3ºC |
| Exact Mass | 212.13100 |
| PSA | 19.03000 |
| LogP | 2.51090 |
| Vapour Pressure | 1.67E-05mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | RRLDTKNWNRBUBK-UHFFFAOYSA-N |
| SMILES | c1ccc(CN2CCc3[nH]ccc3C2)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD02320628 |