Antimycin A4 structure
|
Common Name | Antimycin A4 | ||
|---|---|---|---|---|
| CAS Number | 27220-59-3 | Molecular Weight | 506.54500 | |
| Density | 1.27g/cm3 | Boiling Point | 744.9ºC at 760mmHg | |
| Molecular Formula | C25H34N2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 404.3ºC | |
| Name | [8-butyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 744.9ºC at 760mmHg |
| Molecular Formula | C25H34N2O9 |
| Molecular Weight | 506.54500 |
| Flash Point | 404.3ºC |
| Exact Mass | 506.22600 |
| PSA | 164.31000 |
| LogP | 3.67850 |
| Vapour Pressure | 6.02E-23mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | GYANSQKXOLFAFP-UHFFFAOYSA-N |
| SMILES | CCCCC1C(=O)OC(C)C(NC(=O)c2cccc(NC=O)c2O)C(=O)OC(C)C1OC(=O)CCC |
| RIDADR | UN 3172 |
|---|---|
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| EINECS 248-343-7 |
| Butyric acid,N-ester with N-(7-butyl-8-hydroxy-4,9-dimethyl-2,6-dioxo-1,6-dioxonan-3-yl)-3-formamidosalicylamide |
| Antimycin A4 |
| 8-Butyl-3-(3-formamido-2-hydroxybenzamido)-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl butyrate |
| Antimycin A4 (7CI,9CI) |