Oleana-2,12-dien-28-oic acid
Modify Date: 2025-09-10 20:24:47
Oleana-2,12-dien-28-oic acid structure
|
Common Name | Oleana-2,12-dien-28-oic acid | ||
|---|---|---|---|---|
| CAS Number | 272108-04-0 | Molecular Weight | 438.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H46O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Oleana-2,12-dien-28-oic acidOleana-2,12-dien-28-oic acid is an HBV-DNA inhibitor, HBsAg and HBeAg inhibitor. Oleana-2,12-dien-28-oic acid can be used in hepatitis B virus infection disease research[1]. |
| Name | Oleana-2,12-dien-28-oic acid |
|---|
| Description | Oleana-2,12-dien-28-oic acid is an HBV-DNA inhibitor, HBsAg and HBeAg inhibitor. Oleana-2,12-dien-28-oic acid can be used in hepatitis B virus infection disease research[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Oleana-2,12-dien-28-oic acid (4-100 μg/mL; 7 d) shows the inhibition on hepatitis B surface antigen (HBsAg) and hepatitis B e antigen (HBeAg) secreted by HepG2.2.15 cells[1]. Oleana-2,12-dien-28-oic acid (4-100 μg/mL; 7 d) inhibits the replication of hepatitis B virus deoxyribonucleic acid (HBV-DNA) of HepG2.2.15 cells[1]. Cell Viability Assay[1] Cell Line: HepG2 .2 .15 cells Concentration: 4, 20, 100 μg/mL Incubation Time: 7 days Result: Inhibited hepatitis B surface antigen (HBsAg) of 60.5%, 69.8%, and 85.3% at 4, 20, and 100 μg/mL, respectively. Inhibited hepatitis B e antigen (HBeAg) of 45.1%, 60.5%, and 76.9% at 4, 20, and 100 μg/mL, respectively. |
| References |
| Molecular Formula | C30H46O2 |
|---|---|
| Molecular Weight | 438.68 |
| InChIKey | QUWBANZMJKHMKL-CDNBJWEZSA-N |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC=CC(C)(C)C5CCC43C)C2C1 |