Thonningianin A structure
|
Common Name | Thonningianin A | ||
|---|---|---|---|---|
| CAS Number | 271579-11-4 | Molecular Weight | 872.734 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 1365.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C42H34O21 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 412.3±27.8 °C | |
Use of Thonningianin AThonningianin A, an ellagitannin, is isolated from the methanolic extract of the African medicinal herb, Thonningia sanguinea. The antioxidant properties of Th A involve radical scavenging, anti-superoxide formation and metal chelation. Anti-cancer activities[1][2]. |
| Name | 13-[3,5-Dihydroxy-4-(3-phenylpropanoyl)phenoxy]-2,3,4,5,6,7,14-heptahydroxy-15-[2-oxo-2-(3,4,5-trihydroxyphenyl)ethyl]-11,11a,13,14,15,15a-hexahydrodibenzo[g,i]pyrano[3,2-b][1,5]dioxacycloundecine-9,17-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Thonningianin A, an ellagitannin, is isolated from the methanolic extract of the African medicinal herb, Thonningia sanguinea. The antioxidant properties of Th A involve radical scavenging, anti-superoxide formation and metal chelation. Anti-cancer activities[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Thonningianin A effectively inhibited the proliferation of HepG-2 cells by inducing apoptosis, as evidenced by increase in the sub-G1 cell population, DNA fragmentation, and increase in the content of reactive oxygen species[2]. |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 1365.2±65.0 °C at 760 mmHg |
| Molecular Formula | C42H34O21 |
| Molecular Weight | 872.734 |
| Flash Point | 412.3±27.8 °C |
| Exact Mass | 872.179993 |
| LogP | 6.13 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.733 |
| InChIKey | XQVKQEFQGYTUAR-VHBRHXFYSA-N |
| SMILES | O=C(OC1C(O)C(Oc2cc(O)c(C(=O)CCc3ccccc3)c(O)c2)OC2COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)OC21)c1cc(O)c(O)c(O)c1 |
| Storage condition | -20℃ |
| 13-[3,5-Dihydroxy-4-(3-phenylpropanoyl)phenoxy]-2,3,4,5,6,7,14-heptahydroxy-15-[2-oxo-2-(3,4,5-trihydroxyphenyl)ethyl]-11,11a,13,14,15,15a-hexahydrodibenzo[g,i]pyrano[3,2-b][1,5]dioxacycloundecine-9,17-dione |
| Dibenzo[g,i]pyrano[3,2-b][1,5]dioxacycloundecin-9,17-dione, 13-[3,5-dihydroxy-4-(1-oxo-3-phenylpropyl)phenoxy]-11,11a,13,14,15,15a-hexahydro-2,3,4,5,6,7,14-heptahydroxy-15-[2-oxo-2-(3,4,5-trihydroxyphenyl)ethyl]- |
| Thonningianin A |