2(3H)-Benzoxazolone, 5-chloro-6-nitro- structure
|
Common Name | 2(3H)-Benzoxazolone, 5-chloro-6-nitro- | ||
|---|---|---|---|---|
| CAS Number | 27087-06-5 | Molecular Weight | 214.56300 | |
| Density | 1.704g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H3ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-6-nitro-3H-1,3-benzoxazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.704g/cm3 |
|---|---|
| Molecular Formula | C7H3ClN2O4 |
| Molecular Weight | 214.56300 |
| Exact Mass | 213.97800 |
| PSA | 91.82000 |
| LogP | 2.20590 |
| Index of Refraction | 1.646 |
| InChIKey | UXRRICZTIWOWDF-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2cc(Cl)c([N+](=O)[O-])cc2o1 |
| HS Code | 2934999090 |
|---|
|
~%
2(3H)-Benzoxazo... CAS#:27087-06-5 |
| Literature: Baxter,I. et al. Journal of the Chemical Society [Section] C: Organic, 1970 , p. 850 - 853 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-chloro-6-nitro-3H-benzooxazol-2-one |
| 5-chloro-6-nitro-benzoxazol-2-one |
| 5-Chlor-6-nitro-3H-benzoxazol-2-on |
| 5-chloro-6-nitro-2-benzooxazolinone |
| 5-chloro-6-nitro-3H-benzoxazol-2-one |
| 2-Oxo-5-chloro-6-nitrobenzoxazoline |